C13H20N4O5S3 — CID 59675810
N-tert-butyl-4-[(4-ethoxy-1-oxo-1,2,5-thiadiazol-3-yl)amino]-3-hydroxy-N-methylthiophene-2-sulfonamide (PubChem CID 59675810) has the molecular formula C13H20N4O5S3 and a molecular weight of 408.53 g/mol. Its IUPAC name is N-tert-butyl-4-[(4-ethoxy-1-oxo-1,2,5-thiadiazol-3-yl)amino]-3-hydroxy-N-methylthiophene-2-sulfonamide.
| Compound Name | N-tert-butyl-4-[(4-ethoxy-1-oxo-1,2,5-thiadiazol-3-yl)amino]-3-hydroxy-N-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 59675810 |
| Molecular Formula | C13H20N4O5S3 |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | N-tert-butyl-4-[(4-ethoxy-1-oxo-1,2,5-thiadiazol-3-yl)amino]-3-hydroxy-N-methylthiophene-2-sulfonamide |
| SMILES | CCOC1=NS(=O)N=C1Nc1csc(S(=O)(=O)N(C)C(C)(C)C)c1O |
| InChI | InChI=1S/C13H20N4O5S3/c1-6-22-11-10(15-24(19)16-11)14-8-7-23-12(9(8)18)25(20,21)17(5)13(2,3)4/h7,18H,6H2,1-5H3,(H,14,15) |
| InChIKey | JCUAIRIZLQBDMQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 120.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|