C19H23F15O3 — CID 59676489
1,1,1,3,3,3-hexafluoro-2-[4-[1,1,1,3,3,3-hexafluoro-2-[2-(1,1,1-trifluoro-2-methylbutan-2-yl)oxyethoxy]propan-2-yl]cyclohexyl]propan-2-ol (PubChem CID 59676489) has the molecular formula C19H23F15O3 and a molecular weight of 584.36 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[4-[1,1,1,3,3,3-hexafluoro-2-[2-(1,1,1-trifluoro-2-methylbutan-2-yl)oxyethoxy]propan-2-yl]cyclohexyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[4-[1,1,1,3,3,3-hexafluoro-2-[2-(1,1,1-trifluoro-2-methylbutan-2-yl)oxyethoxy]propan-2-yl]cyclohexyl]propan-2-ol |
|---|---|
| PubChem CID | 59676489 |
| Molecular Formula | C19H23F15O3 |
| Molecular Weight | 584.36 g/mol |
| Exact Mass | 584.14 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[4-[1,1,1,3,3,3-hexafluoro-2-[2-(1,1,1-trifluoro-2-methylbutan-2-yl)oxyethoxy]propan-2-yl]cyclohexyl]propan-2-ol |
| SMILES | CCC(C)(OCCOC(C1CCC(C(O)(C(F)(F)F)C(F)(F)F)CC1)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C19H23F15O3/c1-3-12(2,15(20,21)22)36-8-9-37-14(18(29,30)31,19(32,33)34)11-6-4-10(5-7-11)13(35,16(23,24)25)17(26,27)28/h10-11,35H,3-9H2,1-2H3 |
| InChIKey | YJVWPHXSUHJETM-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.36 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|