C18H26F4O4S — CID 59676511
1-(2-butyloctoxy)-2,3,4,5-tetrafluoro-6-(trioxidanylsulfanyl)benzene (PubChem CID 59676511) has the molecular formula C18H26F4O4S and a molecular weight of 414.46 g/mol. Its IUPAC name is 1-(2-butyloctoxy)-2,3,4,5-tetrafluoro-6-(trioxidanylsulfanyl)benzene.
| Compound Name | 1-(2-butyloctoxy)-2,3,4,5-tetrafluoro-6-(trioxidanylsulfanyl)benzene |
|---|---|
| PubChem CID | 59676511 |
| Molecular Formula | C18H26F4O4S |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 1-(2-butyloctoxy)-2,3,4,5-tetrafluoro-6-(trioxidanylsulfanyl)benzene |
| SMILES | CCCCCCC(CCCC)COc1c(F)c(F)c(F)c(F)c1SOOO |
| InChI | InChI=1S/C18H26F4O4S/c1-3-5-7-8-10-12(9-6-4-2)11-24-17-15(21)13(19)14(20)16(22)18(17)27-26-25-23/h12,23H,3-11H2,1-2H3 |
| InChIKey | HGJHWXRLPASDPQ-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|