C22H34F4O4S — CID 59676538
1,2,3,4-tetrafluoro-5-(2-hexyldecoxy)-6-(trioxidanylsulfanyl)benzene (PubChem CID 59676538) has the molecular formula C22H34F4O4S and a molecular weight of 470.57 g/mol. Its IUPAC name is 1,2,3,4-tetrafluoro-5-(2-hexyldecoxy)-6-(trioxidanylsulfanyl)benzene.
| Compound Name | 1,2,3,4-tetrafluoro-5-(2-hexyldecoxy)-6-(trioxidanylsulfanyl)benzene |
|---|---|
| PubChem CID | 59676538 |
| Molecular Formula | C22H34F4O4S |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | 1,2,3,4-tetrafluoro-5-(2-hexyldecoxy)-6-(trioxidanylsulfanyl)benzene |
| SMILES | CCCCCCCCC(CCCCCC)COc1c(F)c(F)c(F)c(F)c1SOOO |
| InChI | InChI=1S/C22H34F4O4S/c1-3-5-7-9-10-12-14-16(13-11-8-6-4-2)15-28-21-19(25)17(23)18(24)20(26)22(21)31-30-29-27/h16,27H,3-15H2,1-2H3 |
| InChIKey | XIWNFWMHESOTFW-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|