C25H29F5O4SSi — CID 59676665
trans-(2S,4R)-4-(2,5-difluorophenyl)-4-[4-(trifluoromethyl)phenyl]sulfonyl-2-(2-trimethylsilylethoxymethyl)cyclohexan-1-one (PubChem CID 59676665) has the molecular formula C25H29F5O4SSi and a molecular weight of 548.65 g/mol. Its IUPAC name is trans-(2S,4R)-4-(2,5-difluorophenyl)-4-[4-(trifluoromethyl)phenyl]sulfonyl-2-(2-trimethylsilylethoxymethyl)cyclohexan-1-one.
| Compound Name | trans-(2S,4R)-4-(2,5-difluorophenyl)-4-[4-(trifluoromethyl)phenyl]sulfonyl-2-(2-trimethylsilylethoxymethyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 59676665 |
| Molecular Formula | C25H29F5O4SSi |
| Molecular Weight | 548.65 g/mol |
| Exact Mass | 548.15 |
| IUPAC Name | trans-(2S,4R)-4-(2,5-difluorophenyl)-4-[4-(trifluoromethyl)phenyl]sulfonyl-2-(2-trimethylsilylethoxymethyl)cyclohexan-1-one |
| SMILES | C[Si](C)(C)CCOC[C@@H]1C[C@](c2cc(F)ccc2F)(S(=O)(=O)c2ccc(C(F)(F)F)cc2)CCC1=O |
| InChI | InChI=1S/C25H29F5O4SSi/c1-36(2,3)13-12-34-16-17-15-24(11-10-23(17)31,21-14-19(26)6-9-22(21)27)35(32,33)20-7-4-18(5-8-20)25(28,29)30/h4-9,14,17H,10-13,15-16H2,1-3H3/t17-,24+/m0/s1 |
| InChIKey | PVGVPLSYTKICQG-BXKMTCNYSA-N |
| XLogP | 6.38 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.65 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|