C29H41NO4Si — CID 59676903
tert-butyl N-[(1R,2R,5S)-2-[tert-butyl(diphenyl)silyl]oxy-5-(2-oxoethyl)cyclohexyl]carbamate (PubChem CID 59676903) has the molecular formula C29H41NO4Si and a molecular weight of 495.74 g/mol. Its IUPAC name is tert-butyl N-[(1R,2R,5S)-2-[tert-butyl(diphenyl)silyl]oxy-5-(2-oxoethyl)cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(1R,2R,5S)-2-[tert-butyl(diphenyl)silyl]oxy-5-(2-oxoethyl)cyclohexyl]carbamate |
|---|---|
| PubChem CID | 59676903 |
| Molecular Formula | C29H41NO4Si |
| Molecular Weight | 495.74 g/mol |
| Exact Mass | 495.28 |
| IUPAC Name | tert-butyl N-[(1R,2R,5S)-2-[tert-butyl(diphenyl)silyl]oxy-5-(2-oxoethyl)cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C[C@@H](CC=O)CC[C@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C29H41NO4Si/c1-28(2,3)33-27(32)30-25-21-22(19-20-31)17-18-26(25)34-35(29(4,5)6,23-13-9-7-10-14-23)24-15-11-8-12-16-24/h7-16,20,22,25-26H,17-19,21H2,1-6H3,(H,30,32)/t22-,25-,26-/m1/s1 |
| InChIKey | SZJGDSLTEDLPBZ-DNRSQYFGSA-N |
| XLogP | 5.21 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.74 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|