C20H28ClN5O5S — CID 59676928
tert-butyl N-[(3R,4S)-4-[[2-[(5-chloro-2-pyridinyl)amino]-2-oxoacetyl]amino]-1-(2-methoxyethanethioyl)piperidin-3-yl]carbamate (PubChem CID 59676928) has the molecular formula C20H28ClN5O5S and a molecular weight of 485.99 g/mol. Its IUPAC name is tert-butyl N-[(3R,4S)-4-[[2-[(5-chloro-2-pyridinyl)amino]-2-oxoacetyl]amino]-1-(2-methoxyethanethioyl)piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R,4S)-4-[[2-[(5-chloro-2-pyridinyl)amino]-2-oxoacetyl]amino]-1-(2-methoxyethanethioyl)piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 59676928 |
| Molecular Formula | C20H28ClN5O5S |
| Molecular Weight | 485.99 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | tert-butyl N-[(3R,4S)-4-[[2-[(5-chloro-2-pyridinyl)amino]-2-oxoacetyl]amino]-1-(2-methoxyethanethioyl)piperidin-3-yl]carbamate |
| SMILES | COCC(=S)N1CC[C@H](NC(=O)C(=O)Nc2ccc(Cl)cn2)[C@H](NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C20H28ClN5O5S/c1-20(2,3)31-19(29)24-14-10-26(16(32)11-30-4)8-7-13(14)23-17(27)18(28)25-15-6-5-12(21)9-22-15/h5-6,9,13-14H,7-8,10-11H2,1-4H3,(H,23,27)(H,24,29)(H,22,25,28)/t13-,14+/m0/s1 |
| InChIKey | NBTYYWQKNFGFON-UONOGXRCSA-N |
| XLogP | 1.73 |
| TPSA | 121.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.99 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|