C31H46N2O4Si — CID 59676958
tert-butyl N-[(1R,2R,5S)-2-[tert-butyl(diphenyl)silyl]oxy-5-[2-(dimethylamino)-2-oxoethyl]cyclohexyl]carbamate (PubChem CID 59676958) has the molecular formula C31H46N2O4Si and a molecular weight of 538.81 g/mol. Its IUPAC name is tert-butyl N-[(1R,2R,5S)-2-[tert-butyl(diphenyl)silyl]oxy-5-[2-(dimethylamino)-2-oxoethyl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(1R,2R,5S)-2-[tert-butyl(diphenyl)silyl]oxy-5-[2-(dimethylamino)-2-oxoethyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 59676958 |
| Molecular Formula | C31H46N2O4Si |
| Molecular Weight | 538.81 g/mol |
| Exact Mass | 538.32 |
| IUPAC Name | tert-butyl N-[(1R,2R,5S)-2-[tert-butyl(diphenyl)silyl]oxy-5-[2-(dimethylamino)-2-oxoethyl]cyclohexyl]carbamate |
| SMILES | CN(C)C(=O)C[C@H]1CC[C@@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H](NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C31H46N2O4Si/c1-30(2,3)36-29(35)32-26-21-23(22-28(34)33(7)8)19-20-27(26)37-38(31(4,5)6,24-15-11-9-12-16-24)25-17-13-10-14-18-25/h9-18,23,26-27H,19-22H2,1-8H3,(H,32,35)/t23-,26+,27+/m0/s1 |
| InChIKey | YFBCSCQJQJICID-HUROMRQRSA-N |
| XLogP | 5.10 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.81 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|