C25H25ClN4O2S — CID 59677166
13-chloro-9-[(E)-2-(1H-imidazol-5-yl)ethenyl]-2-(1-methylsulfonylpiperidin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene (PubChem CID 59677166) has the molecular formula C25H25ClN4O2S and a molecular weight of 481.02 g/mol. Its IUPAC name is 13-chloro-9-[(E)-2-(1H-imidazol-5-yl)ethenyl]-2-(1-methylsulfonylpiperidin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene.
| Compound Name | 13-chloro-9-[(E)-2-(1H-imidazol-5-yl)ethenyl]-2-(1-methylsulfonylpiperidin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene |
|---|---|
| PubChem CID | 59677166 |
| Molecular Formula | C25H25ClN4O2S |
| Molecular Weight | 481.02 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | 13-chloro-9-[(E)-2-(1H-imidazol-5-yl)ethenyl]-2-(1-methylsulfonylpiperidin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene |
| SMILES | CS(=O)(=O)N1CCC(C2c3ccc(Cl)cc3C=C(/C=C/c3cnc[nH]3)c3cccnc32)CC1 |
| InChI | InChI=1S/C25H25ClN4O2S/c1-33(31,32)30-11-8-17(9-12-30)24-22-7-5-20(26)14-19(22)13-18(4-6-21-15-27-16-29-21)23-3-2-10-28-25(23)24/h2-7,10,13-17,24H,8-9,11-12H2,1H3,(H,27,29)/b6-4+ |
| InChIKey | QKYRBGZCVPTCGC-GQCTYLIASA-N |
| XLogP | 4.83 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.02 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |