C23H27ClN2O3S — CID 59677211
3-[13-chloro-2-(1-methylperoxysulfanylpiperidin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-9-yl]propan-1-ol (PubChem CID 59677211) has the molecular formula C23H27ClN2O3S and a molecular weight of 447.00 g/mol. Its IUPAC name is 3-[13-chloro-2-(1-methylperoxysulfanylpiperidin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-9-yl]propan-1-ol.
| Compound Name | 3-[13-chloro-2-(1-methylperoxysulfanylpiperidin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-9-yl]propan-1-ol |
|---|---|
| PubChem CID | 59677211 |
| Molecular Formula | C23H27ClN2O3S |
| Molecular Weight | 447.00 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 3-[13-chloro-2-(1-methylperoxysulfanylpiperidin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-9-yl]propan-1-ol |
| SMILES | COOSN1CCC(C2c3ccc(Cl)cc3C=C(CCCO)c3cccnc32)CC1 |
| InChI | InChI=1S/C23H27ClN2O3S/c1-28-29-30-26-11-8-16(9-12-26)22-20-7-6-19(24)15-18(20)14-17(4-3-13-27)21-5-2-10-25-23(21)22/h2,5-7,10,14-16,22,27H,3-4,8-9,11-13H2,1H3 |
| InChIKey | GDTXCTJHCLGWMH-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.00 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|