C27H31ClN4O2S — CID 59677384
13-chloro-9-[3-(5-methylimidazol-1-yl)propyl]-2-(1-methylperoxysulfanylpiperidin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene (PubChem CID 59677384) has the molecular formula C27H31ClN4O2S and a molecular weight of 511.09 g/mol. Its IUPAC name is 13-chloro-9-[3-(5-methylimidazol-1-yl)propyl]-2-(1-methylperoxysulfanylpiperidin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene.
| Compound Name | 13-chloro-9-[3-(5-methylimidazol-1-yl)propyl]-2-(1-methylperoxysulfanylpiperidin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene |
|---|---|
| PubChem CID | 59677384 |
| Molecular Formula | C27H31ClN4O2S |
| Molecular Weight | 511.09 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | 13-chloro-9-[3-(5-methylimidazol-1-yl)propyl]-2-(1-methylperoxysulfanylpiperidin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene |
| SMILES | COOSN1CCC(C2c3ccc(Cl)cc3C=C(CCCn3cncc3C)c3cccnc32)CC1 |
| InChI | InChI=1S/C27H31ClN4O2S/c1-19-17-29-18-31(19)12-4-5-21-15-22-16-23(28)7-8-24(22)26(27-25(21)6-3-11-30-27)20-9-13-32(14-10-20)35-34-33-2/h3,6-8,11,15-18,20,26H,4-5,9-10,12-14H2,1-2H3 |
| InChIKey | HPYHEQUERZMLQT-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.09 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|