C21H23ClN2O3S — CID 59677407
[13-chloro-2-(1-methylsulfonylpiperidin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-9-yl]methanol (PubChem CID 59677407) has the molecular formula C21H23ClN2O3S and a molecular weight of 418.95 g/mol. Its IUPAC name is [13-chloro-2-(1-methylsulfonylpiperidin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-9-yl]methanol.
| Compound Name | [13-chloro-2-(1-methylsulfonylpiperidin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-9-yl]methanol |
|---|---|
| PubChem CID | 59677407 |
| Molecular Formula | C21H23ClN2O3S |
| Molecular Weight | 418.95 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | [13-chloro-2-(1-methylsulfonylpiperidin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-9-yl]methanol |
| SMILES | CS(=O)(=O)N1CCC(C2c3ccc(Cl)cc3C=C(CO)c3cccnc32)CC1 |
| InChI | InChI=1S/C21H23ClN2O3S/c1-28(26,27)24-9-6-14(7-10-24)20-18-5-4-17(22)12-15(18)11-16(13-25)19-3-2-8-23-21(19)20/h2-5,8,11-12,14,20,25H,6-7,9-10,13H2,1H3 |
| InChIKey | WJSHDTSUKAPYGX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.95 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |