C24H25ClN8O2S — CID 59677431
(2S)-10-[azido-(3-methylimidazol-4-yl)methyl]-13-chloro-2-(4-methylsulfonylpiperazin-1-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene (PubChem CID 59677431) has the molecular formula C24H25ClN8O2S and a molecular weight of 525.04 g/mol. Its IUPAC name is (2S)-10-[azido-(3-methylimidazol-4-yl)methyl]-13-chloro-2-(4-methylsulfonylpiperazin-1-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene.
| Compound Name | (2S)-10-[azido-(3-methylimidazol-4-yl)methyl]-13-chloro-2-(4-methylsulfonylpiperazin-1-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene |
|---|---|
| PubChem CID | 59677431 |
| Molecular Formula | C24H25ClN8O2S |
| Molecular Weight | 525.04 g/mol |
| Exact Mass | 524.15 |
| IUPAC Name | (2S)-10-[azido-(3-methylimidazol-4-yl)methyl]-13-chloro-2-(4-methylsulfonylpiperazin-1-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene |
| SMILES | Cn1cncc1C(N=[N+]=[N-])C1=Cc2cccnc2[C@@H](N2CCN(S(C)(=O)=O)CC2)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C24H25ClN8O2S/c1-31-15-27-14-21(31)23(29-30-26)20-12-16-4-3-7-28-22(16)24(18-6-5-17(25)13-19(18)20)32-8-10-33(11-9-32)36(2,34)35/h3-7,12-15,23-24H,8-11H2,1-2H3/t23?,24-/m0/s1 |
| InChIKey | RPWDODNAQDJTRO-CGAIIQECSA-N |
| XLogP | 4.04 |
| TPSA | 120.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.04 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|