C22H25ClN2O5S2 — CID 59677503
[13-chloro-2-(1-methylsulfonylpiperidin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-9-yl]methyl methanesulfonate (PubChem CID 59677503) has the molecular formula C22H25ClN2O5S2 and a molecular weight of 497.04 g/mol. Its IUPAC name is [13-chloro-2-(1-methylsulfonylpiperidin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-9-yl]methyl methanesulfonate.
| Compound Name | [13-chloro-2-(1-methylsulfonylpiperidin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-9-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 59677503 |
| Molecular Formula | C22H25ClN2O5S2 |
| Molecular Weight | 497.04 g/mol |
| Exact Mass | 496.09 |
| IUPAC Name | [13-chloro-2-(1-methylsulfonylpiperidin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-9-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OCC1=Cc2cc(Cl)ccc2C(C2CCN(S(C)(=O)=O)CC2)c2ncccc21 |
| InChI | InChI=1S/C22H25ClN2O5S2/c1-31(26,27)25-10-7-15(8-11-25)21-19-6-5-18(23)13-16(19)12-17(14-30-32(2,28)29)20-4-3-9-24-22(20)21/h3-6,9,12-13,15,21H,7-8,10-11,14H2,1-2H3 |
| InChIKey | ZYUIFUOJCURUNX-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.04 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|