C33H33ClN4O2S — CID 59677511
N-benzyl-N-[[13-chloro-2-(1-methylsulfonylpiperidin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-9-yl]methyl]pyridin-2-amine (PubChem CID 59677511) has the molecular formula C33H33ClN4O2S and a molecular weight of 585.17 g/mol. Its IUPAC name is N-benzyl-N-[[13-chloro-2-(1-methylsulfonylpiperidin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-9-yl]methyl]pyridin-2-amine.
| Compound Name | N-benzyl-N-[[13-chloro-2-(1-methylsulfonylpiperidin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-9-yl]methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 59677511 |
| Molecular Formula | C33H33ClN4O2S |
| Molecular Weight | 585.17 g/mol |
| Exact Mass | 584.20 |
| IUPAC Name | N-benzyl-N-[[13-chloro-2-(1-methylsulfonylpiperidin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-9-yl]methyl]pyridin-2-amine |
| SMILES | CS(=O)(=O)N1CCC(C2c3ccc(Cl)cc3C=C(CN(Cc3ccccc3)c3ccccn3)c3cccnc32)CC1 |
| InChI | InChI=1S/C33H33ClN4O2S/c1-41(39,40)38-18-14-25(15-19-38)32-29-13-12-28(34)21-26(29)20-27(30-10-7-17-36-33(30)32)23-37(31-11-5-6-16-35-31)22-24-8-3-2-4-9-24/h2-13,16-17,20-21,25,32H,14-15,18-19,22-23H2,1H3 |
| InChIKey | SHBKFTPSAMRLOJ-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.17 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |