C29H58O6Si — CID 59678389
(Z,2S,3R,4S,8S,9R,10R)-9-[tert-butyl(dimethyl)silyl]oxy-10-[(2S,4S,5S)-2,5-dimethyl-1,3-dioxan-4-yl]-3-(methoxymethoxy)-2,4,6,8-tetramethylundec-5-en-1-ol (PubChem CID 59678389) has the molecular formula C29H58O6Si and a molecular weight of 530.86 g/mol. Its IUPAC name is (Z,2S,3R,4S,8S,9R,10R)-9-[tert-butyl(dimethyl)silyl]oxy-10-[(2S,4S,5S)-2,5-dimethyl-1,3-dioxan-4-yl]-3-(methoxymethoxy)-2,4,6,8-tetramethylundec-5-en-1-ol.
| Compound Name | (Z,2S,3R,4S,8S,9R,10R)-9-[tert-butyl(dimethyl)silyl]oxy-10-[(2S,4S,5S)-2,5-dimethyl-1,3-dioxan-4-yl]-3-(methoxymethoxy)-2,4,6,8-tetramethylundec-5-en-1-ol |
|---|---|
| PubChem CID | 59678389 |
| Molecular Formula | C29H58O6Si |
| Molecular Weight | 530.86 g/mol |
| Exact Mass | 530.40 |
| IUPAC Name | (Z,2S,3R,4S,8S,9R,10R)-9-[tert-butyl(dimethyl)silyl]oxy-10-[(2S,4S,5S)-2,5-dimethyl-1,3-dioxan-4-yl]-3-(methoxymethoxy)-2,4,6,8-tetramethylundec-5-en-1-ol |
| SMILES | COCO[C@H]([C@@H](C)/C=C(/C)C[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@H]1O[C@@H](C)OC[C@@H]1C)[C@@H](C)CO |
| InChI | InChI=1S/C29H58O6Si/c1-19(14-20(2)26(22(4)16-30)33-18-31-11)15-21(3)28(35-36(12,13)29(8,9)10)24(6)27-23(5)17-32-25(7)34-27/h14,20-28,30H,15-18H2,1-13H3/b19-14-/t20-,21-,22-,23-,24+,25-,26+,27-,28+/m0/s1 |
| InChIKey | JCMCPOVGIHMSHU-SHSLGDQCSA-N |
| XLogP | 6.64 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.86 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|