C19H38OSi — CID 59678391
tert-butyl-[(1S,2S,5S)-3-(3,3-dimethylbut-1-en-2-yl)-2,5-dimethylcyclopentyl]oxy-dimethylsilane (PubChem CID 59678391) has the molecular formula C19H38OSi and a molecular weight of 310.60 g/mol. Its IUPAC name is tert-butyl-[(1S,2S,5S)-3-(3,3-dimethylbut-1-en-2-yl)-2,5-dimethylcyclopentyl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1S,2S,5S)-3-(3,3-dimethylbut-1-en-2-yl)-2,5-dimethylcyclopentyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 59678391 |
| Molecular Formula | C19H38OSi |
| Molecular Weight | 310.60 g/mol |
| Exact Mass | 310.27 |
| IUPAC Name | tert-butyl-[(1S,2S,5S)-3-(3,3-dimethylbut-1-en-2-yl)-2,5-dimethylcyclopentyl]oxy-dimethylsilane |
| SMILES | C=C(C1C[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1C)C(C)(C)C |
| InChI | InChI=1S/C19H38OSi/c1-13-12-16(15(3)18(4,5)6)14(2)17(13)20-21(10,11)19(7,8)9/h13-14,16-17H,3,12H2,1-2,4-11H3/t13-,14-,16?,17-/m0/s1 |
| InChIKey | JTZCFQDPJADZEQ-KHFHPKRRSA-N |
| XLogP | 6.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.60 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|