C11H22O2 — CID 59678397
(2S,3R,4S)-3-methoxy-2,4,6-trimethylhept-5-en-1-ol (PubChem CID 59678397) has the molecular formula C11H22O2 and a molecular weight of 186.29 g/mol. Its IUPAC name is (2S,3R,4S)-3-methoxy-2,4,6-trimethylhept-5-en-1-ol.
| Compound Name | (2S,3R,4S)-3-methoxy-2,4,6-trimethylhept-5-en-1-ol |
|---|---|
| PubChem CID | 59678397 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | (2S,3R,4S)-3-methoxy-2,4,6-trimethylhept-5-en-1-ol |
| SMILES | CO[C@H]([C@@H](C)C=C(C)C)[C@@H](C)CO |
| InChI | InChI=1S/C11H22O2/c1-8(2)6-9(3)11(13-5)10(4)7-12/h6,9-12H,7H2,1-5H3/t9-,10-,11+/m0/s1 |
| InChIKey | BENPUMOZUMKLRB-GARJFASQSA-N |
| XLogP | 2.23 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|