C16H26O4 — CID 59678402
methyl (1'R,4'aR)-1',4'a-dimethylspiro[1,3-dioxolane-2,5'-3,4,6,7,8,8a-hexahydro-2H-naphthalene]-1'-carboxylate (PubChem CID 59678402) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is methyl (1'R,4'aR)-1',4'a-dimethylspiro[1,3-dioxolane-2,5'-3,4,6,7,8,8a-hexahydro-2H-naphthalene]-1'-carboxylate.
| Compound Name | methyl (1'R,4'aR)-1',4'a-dimethylspiro[1,3-dioxolane-2,5'-3,4,6,7,8,8a-hexahydro-2H-naphthalene]-1'-carboxylate |
|---|---|
| PubChem CID | 59678402 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | methyl (1'R,4'aR)-1',4'a-dimethylspiro[1,3-dioxolane-2,5'-3,4,6,7,8,8a-hexahydro-2H-naphthalene]-1'-carboxylate |
| SMILES | COC(=O)[C@]1(C)CCC[C@]2(C)C1CCCC21OCCO1 |
| InChI | InChI=1S/C16H26O4/c1-14(13(17)18-3)7-5-8-15(2)12(14)6-4-9-16(15)19-10-11-20-16/h12H,4-11H2,1-3H3/t12?,14-,15-/m1/s1 |
| InChIKey | WVRCWMVSQOTSMW-JENMUQSASA-N |
| XLogP | 2.90 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |