About 2-[(5-oxo-4H-1,3-oxazol-4-id-2-yl)methyl]-4H-1,3-oxazol-4-id-5-one;rhenium
2-[(5-oxo-4H-1,3-oxazol-4-id-2-yl)methyl]-4H-1,3-oxazol-4-id-5-one;rhenium (PubChem CID 59678474) has the molecular formula C7H4N2O4Re4-2
and a molecular weight of 924.95 g/mol. Its IUPAC name is 2-[(5-oxo-4H-1,3-oxazol-4-id-2-yl)methyl]-4H-1,3-oxazol-4-id-5-one;rhenium.
Molecular Properties
| Compound Name | 2-[(5-oxo-4H-1,3-oxazol-4-id-2-yl)methyl]-4H-1,3-oxazol-4-id-5-one;rhenium |
| PubChem CID | 59678474 |
| Molecular Formula | C7H4N2O4Re4-2 |
| Molecular Weight | 924.95 g/mol |
| Exact Mass | 927.84 |
| IUPAC Name | 2-[(5-oxo-4H-1,3-oxazol-4-id-2-yl)methyl]-4H-1,3-oxazol-4-id-5-one;rhenium |
| SMILES | O=c1[cH-]nc(Cc2n[cH-]c(=O)o2)o1.[Re].[Re].[Re].[Re] |
| InChI | InChI=1S/C7H4N2O4.4Re/c10-6-2-8-4(12-6)1-5-9-3-7(11)13-5;;;;/h2-3H,1H2;;;;/q-2;;;; |
| InChIKey | UUOBRIDRZAEJHO-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 86.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 924.95 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-[(5-oxo-4H-1,3-oxazol-4-id-2-yl)methyl]-4H-1,3-oxazol-4-id-5-one;rhenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-oxo-4H-1,3-oxazol-4-id-2-yl)methyl]-4H-1,3-oxazol-4-id-5-one;rhenium?
The IUPAC name of 2-[(5-oxo-4H-1,3-oxazol-4-id-2-yl)methyl]-4H-1,3-oxazol-4-id-5-one;rhenium (CID 59678474) is 2-[(5-oxo-4H-1,3-oxazol-4-id-2-yl)methyl]-4H-1,3-oxazol-4-id-5-one;rhenium.
What is the SMILES notation for 2-[(5-oxo-4H-1,3-oxazol-4-id-2-yl)methyl]-4H-1,3-oxazol-4-id-5-one;rhenium?
The canonical SMILES for 2-[(5-oxo-4H-1,3-oxazol-4-id-2-yl)methyl]-4H-1,3-oxazol-4-id-5-one;rhenium is O=c1[cH-]nc(Cc2n[cH-]c(=O)o2)o1.[Re].[Re].[Re].[Re].
What is the InChIKey of 2-[(5-oxo-4H-1,3-oxazol-4-id-2-yl)methyl]-4H-1,3-oxazol-4-id-5-one;rhenium?
The InChIKey is UUOBRIDRZAEJHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4N2O4.4Re/c10-6-2-8-4(12-6)1-5-9-3-7(11)13-5;;;;/h2-3H,1H2;;;;/q-2;;;;.
What are the key properties of 2-[(5-oxo-4H-1,3-oxazol-4-id-2-yl)methyl]-4H-1,3-oxazol-4-id-5-one;rhenium?
2-[(5-oxo-4H-1,3-oxazol-4-id-2-yl)methyl]-4H-1,3-oxazol-4-id-5-one;rhenium has a molecular weight of 924.95 g/mol, XLogP of -0.60, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-oxo-4H-1,3-oxazol-4-id-2-yl)methyl]-4H-1,3-oxazol-4-id-5-one;rhenium is sourced from PubChem (CID 59678474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).