C12H14N2O4 — CID 59678488
5,10-dimethyl-3,12-diazatricyclo[6.4.0.02,7]dodecane-4,6,9,11-tetrone (PubChem CID 59678488) has the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. Its IUPAC name is 5,10-dimethyl-3,12-diazatricyclo[6.4.0.02,7]dodecane-4,6,9,11-tetrone.
| Compound Name | 5,10-dimethyl-3,12-diazatricyclo[6.4.0.02,7]dodecane-4,6,9,11-tetrone |
|---|---|
| PubChem CID | 59678488 |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 5,10-dimethyl-3,12-diazatricyclo[6.4.0.02,7]dodecane-4,6,9,11-tetrone |
| SMILES | CC1C(=O)NC2C3NC(=O)C(C)C(=O)C3C2C1=O |
| InChI | InChI=1S/C12H14N2O4/c1-3-9(15)5-6-8(7(5)13-11(3)17)14-12(18)4(2)10(6)16/h3-8H,1-2H3,(H,13,17)(H,14,18) |
| InChIKey | ZONAZVPEBOTTSR-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|