C9H8F8O2 — CID 59678767
2-(3,3-difluoro-7-oxabicyclo[2.2.1]heptan-2-yl)-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 59678767) has the molecular formula C9H8F8O2 and a molecular weight of 300.15 g/mol. Its IUPAC name is 2-(3,3-difluoro-7-oxabicyclo[2.2.1]heptan-2-yl)-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-(3,3-difluoro-7-oxabicyclo[2.2.1]heptan-2-yl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 59678767 |
| Molecular Formula | C9H8F8O2 |
| Molecular Weight | 300.15 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | 2-(3,3-difluoro-7-oxabicyclo[2.2.1]heptan-2-yl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | OC(C1C2CCC(O2)C1(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H8F8O2/c10-6(11)4-2-1-3(19-4)5(6)7(18,8(12,13)14)9(15,16)17/h3-5,18H,1-2H2 |
| InChIKey | XDDMRVZCECEBAX-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.15 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |