C28H34F2N4O4 — CID 59678998
2-(2-methylphenyl)ethyl (9aS)-6-(4-aminobutyl)-8-[(2,5-difluorophenyl)methyl]-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate (PubChem CID 59678998) has the molecular formula C28H34F2N4O4 and a molecular weight of 528.60 g/mol. Its IUPAC name is 2-(2-methylphenyl)ethyl (9aS)-6-(4-aminobutyl)-8-[(2,5-difluorophenyl)methyl]-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate.
| Compound Name | 2-(2-methylphenyl)ethyl (9aS)-6-(4-aminobutyl)-8-[(2,5-difluorophenyl)methyl]-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate |
|---|---|
| PubChem CID | 59678998 |
| Molecular Formula | C28H34F2N4O4 |
| Molecular Weight | 528.60 g/mol |
| Exact Mass | 528.25 |
| IUPAC Name | 2-(2-methylphenyl)ethyl (9aS)-6-(4-aminobutyl)-8-[(2,5-difluorophenyl)methyl]-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate |
| SMILES | Cc1ccccc1CCOC(=O)N1CCC(=O)N2C(CCCCN)C(=O)N(Cc3cc(F)ccc3F)C[C@H]12 |
| InChI | InChI=1S/C28H34F2N4O4/c1-19-6-2-3-7-20(19)12-15-38-28(37)33-14-11-26(35)34-24(8-4-5-13-31)27(36)32(18-25(33)34)17-21-16-22(29)9-10-23(21)30/h2-3,6-7,9-10,16,24-25H,4-5,8,11-15,17-18,31H2,1H3/t24?,25-/m1/s1 |
| InChIKey | GCHLAGJGKGMLQE-WUBHUQEYSA-N |
| XLogP | 3.35 |
| TPSA | 96.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.60 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|