C28H36N4O4 — CID 59679122
2-(2-methylphenyl)ethyl (9aS)-6-(4-aminobutyl)-8-benzyl-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate (PubChem CID 59679122) has the molecular formula C28H36N4O4 and a molecular weight of 492.62 g/mol. Its IUPAC name is 2-(2-methylphenyl)ethyl (9aS)-6-(4-aminobutyl)-8-benzyl-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate.
| Compound Name | 2-(2-methylphenyl)ethyl (9aS)-6-(4-aminobutyl)-8-benzyl-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate |
|---|---|
| PubChem CID | 59679122 |
| Molecular Formula | C28H36N4O4 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | 2-(2-methylphenyl)ethyl (9aS)-6-(4-aminobutyl)-8-benzyl-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate |
| SMILES | Cc1ccccc1CCOC(=O)N1CCC(=O)N2C(CCCCN)C(=O)N(Cc3ccccc3)C[C@H]12 |
| InChI | InChI=1S/C28H36N4O4/c1-21-9-5-6-12-23(21)15-18-36-28(35)31-17-14-26(33)32-24(13-7-8-16-29)27(34)30(20-25(31)32)19-22-10-3-2-4-11-22/h2-6,9-12,24-25H,7-8,13-20,29H2,1H3/t24?,25-/m1/s1 |
| InChIKey | SZGSBDMSEYCOCN-WUBHUQEYSA-N |
| XLogP | 3.07 |
| TPSA | 96.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|