C29H21Cl2N3O5 — CID 59679406
(2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-(1-methyl-2,4-dioxobenzo[g]quinazolin-3-yl)phenyl]propanoic acid (PubChem CID 59679406) has the molecular formula C29H21Cl2N3O5 and a molecular weight of 562.41 g/mol. Its IUPAC name is (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-(1-methyl-2,4-dioxobenzo[g]quinazolin-3-yl)phenyl]propanoic acid.
| Compound Name | (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-(1-methyl-2,4-dioxobenzo[g]quinazolin-3-yl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 59679406 |
| Molecular Formula | C29H21Cl2N3O5 |
| Molecular Weight | 562.41 g/mol |
| Exact Mass | 561.09 |
| IUPAC Name | (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-(1-methyl-2,4-dioxobenzo[g]quinazolin-3-yl)phenyl]propanoic acid |
| SMILES | Cn1c(=O)n(-c2ccc(C[C@H](NC(=O)c3c(Cl)cccc3Cl)C(=O)O)cc2)c(=O)c2cc3ccccc3cc21 |
| InChI | InChI=1S/C29H21Cl2N3O5/c1-33-24-15-18-6-3-2-5-17(18)14-20(24)27(36)34(29(33)39)19-11-9-16(10-12-19)13-23(28(37)38)32-26(35)25-21(30)7-4-8-22(25)31/h2-12,14-15,23H,13H2,1H3,(H,32,35)(H,37,38)/t23-/m0/s1 |
| InChIKey | QFYLIHDUNMXHSW-QHCPKHFHSA-N |
| XLogP | 4.58 |
| TPSA | 110.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.41 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|