C18H17ClN4O2S — CID 59679490
16-(4-chlorophenyl)sulfonyl-4,8,9,16-tetrazatetracyclo[10.3.1.02,10.05,9]hexadeca-2(10),3,5,7-tetraene (PubChem CID 59679490) has the molecular formula C18H17ClN4O2S and a molecular weight of 388.88 g/mol. Its IUPAC name is 16-(4-chlorophenyl)sulfonyl-4,8,9,16-tetrazatetracyclo[10.3.1.02,10.05,9]hexadeca-2(10),3,5,7-tetraene.
| Compound Name | 16-(4-chlorophenyl)sulfonyl-4,8,9,16-tetrazatetracyclo[10.3.1.02,10.05,9]hexadeca-2(10),3,5,7-tetraene |
|---|---|
| PubChem CID | 59679490 |
| Molecular Formula | C18H17ClN4O2S |
| Molecular Weight | 388.88 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 16-(4-chlorophenyl)sulfonyl-4,8,9,16-tetrazatetracyclo[10.3.1.02,10.05,9]hexadeca-2(10),3,5,7-tetraene |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)N1C2CCCC1c1cnc3ccnn3c1C2 |
| InChI | InChI=1S/C18H17ClN4O2S/c19-12-4-6-14(7-5-12)26(24,25)23-13-2-1-3-16(23)15-11-20-18-8-9-21-22(18)17(15)10-13/h4-9,11,13,16H,1-3,10H2 |
| InChIKey | ZYKKQEPLTSBOTM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 67.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.88 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |