About 1-benzyl-3-(5-methylfuran-2-yl)-[1,3]dioxolo[4,5-f]indazole
1-benzyl-3-(5-methylfuran-2-yl)-[1,3]dioxolo[4,5-f]indazole (PubChem CID 59679642) has the molecular formula C20H16N2O3
and a molecular weight of 332.36 g/mol. Its IUPAC name is 1-benzyl-3-(5-methylfuran-2-yl)-[1,3]dioxolo[4,5-f]indazole.
Molecular Properties
| Compound Name | 1-benzyl-3-(5-methylfuran-2-yl)-[1,3]dioxolo[4,5-f]indazole |
| PubChem CID | 59679642 |
| Molecular Formula | C20H16N2O3 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 1-benzyl-3-(5-methylfuran-2-yl)-[1,3]dioxolo[4,5-f]indazole |
| SMILES | Cc1ccc(-c2nn(Cc3ccccc3)c3cc4c(cc23)OCO4)o1 |
| InChI | InChI=1S/C20H16N2O3/c1-13-7-8-17(25-13)20-15-9-18-19(24-12-23-18)10-16(15)22(21-20)11-14-5-3-2-4-6-14/h2-10H,11-12H2,1H3 |
| InChIKey | DKNMCAGWFADWDR-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 49.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-benzyl-3-(5-methylfuran-2-yl)-[1,3]dioxolo[4,5-f]indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-3-(5-methylfuran-2-yl)-[1,3]dioxolo[4,5-f]indazole?
The IUPAC name of 1-benzyl-3-(5-methylfuran-2-yl)-[1,3]dioxolo[4,5-f]indazole (CID 59679642) is 1-benzyl-3-(5-methylfuran-2-yl)-[1,3]dioxolo[4,5-f]indazole.
What is the SMILES notation for 1-benzyl-3-(5-methylfuran-2-yl)-[1,3]dioxolo[4,5-f]indazole?
The canonical SMILES for 1-benzyl-3-(5-methylfuran-2-yl)-[1,3]dioxolo[4,5-f]indazole is Cc1ccc(-c2nn(Cc3ccccc3)c3cc4c(cc23)OCO4)o1.
What is the InChIKey of 1-benzyl-3-(5-methylfuran-2-yl)-[1,3]dioxolo[4,5-f]indazole?
The InChIKey is DKNMCAGWFADWDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16N2O3/c1-13-7-8-17(25-13)20-15-9-18-19(24-12-23-18)10-16(15)22(21-20)11-14-5-3-2-4-6-14/h2-10H,11-12H2,1H3.
What are the key properties of 1-benzyl-3-(5-methylfuran-2-yl)-[1,3]dioxolo[4,5-f]indazole?
1-benzyl-3-(5-methylfuran-2-yl)-[1,3]dioxolo[4,5-f]indazole has a molecular weight of 332.36 g/mol, XLogP of 4.38, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-3-(5-methylfuran-2-yl)-[1,3]dioxolo[4,5-f]indazole is sourced from PubChem (CID 59679642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).