C30H40N4O3 — CID 59679716
N-[1-[(2S)-3,3-dimethyl-2-[[(2S)-2-(methylamino)propanoyl]amino]butanoyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-6-yl]-2-phenylbenzamide (PubChem CID 59679716) has the molecular formula C30H40N4O3 and a molecular weight of 504.68 g/mol. Its IUPAC name is N-[1-[(2S)-3,3-dimethyl-2-[[(2S)-2-(methylamino)propanoyl]amino]butanoyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-6-yl]-2-phenylbenzamide.
| Compound Name | N-[1-[(2S)-3,3-dimethyl-2-[[(2S)-2-(methylamino)propanoyl]amino]butanoyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-6-yl]-2-phenylbenzamide |
|---|---|
| PubChem CID | 59679716 |
| Molecular Formula | C30H40N4O3 |
| Molecular Weight | 504.68 g/mol |
| Exact Mass | 504.31 |
| IUPAC Name | N-[1-[(2S)-3,3-dimethyl-2-[[(2S)-2-(methylamino)propanoyl]amino]butanoyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-6-yl]-2-phenylbenzamide |
| SMILES | CN[C@@H](C)C(=O)N[C@H](C(=O)N1CCC2CCC(NC(=O)c3ccccc3-c3ccccc3)C21)C(C)(C)C |
| InChI | InChI=1S/C30H40N4O3/c1-19(31-5)27(35)33-26(30(2,3)4)29(37)34-18-17-21-15-16-24(25(21)34)32-28(36)23-14-10-9-13-22(23)20-11-7-6-8-12-20/h6-14,19,21,24-26,31H,15-18H2,1-5H3,(H,32,36)(H,33,35)/t19-,21?,24?,25?,26+/m0/s1 |
| InChIKey | YFTZQAUZKPRALE-STSMVXTLSA-N |
| XLogP | 3.60 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.68 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |