About N,4-dimethyl-1,4-diazepane-1-carboxamide
N,4-dimethyl-1,4-diazepane-1-carboxamide (PubChem CID 59680276) has the molecular formula C8H17N3O
and a molecular weight of 171.24 g/mol. Its IUPAC name is N,4-dimethyl-1,4-diazepane-1-carboxamide.
Molecular Properties
| Compound Name | N,4-dimethyl-1,4-diazepane-1-carboxamide |
| PubChem CID | 59680276 |
| Molecular Formula | C8H17N3O |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.14 |
| IUPAC Name | N,4-dimethyl-1,4-diazepane-1-carboxamide |
| SMILES | CNC(=O)N1CCCN(C)CC1 |
| InChI | InChI=1S/C8H17N3O/c1-9-8(12)11-5-3-4-10(2)6-7-11/h3-7H2,1-2H3,(H,9,12) |
| InChIKey | KFCZJTBNVVJPKU-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,4-dimethyl-1,4-diazepane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,4-dimethyl-1,4-diazepane-1-carboxamide?
The IUPAC name of N,4-dimethyl-1,4-diazepane-1-carboxamide (CID 59680276) is N,4-dimethyl-1,4-diazepane-1-carboxamide.
What is the SMILES notation for N,4-dimethyl-1,4-diazepane-1-carboxamide?
The canonical SMILES for N,4-dimethyl-1,4-diazepane-1-carboxamide is CNC(=O)N1CCCN(C)CC1.
What is the InChIKey of N,4-dimethyl-1,4-diazepane-1-carboxamide?
The InChIKey is KFCZJTBNVVJPKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N3O/c1-9-8(12)11-5-3-4-10(2)6-7-11/h3-7H2,1-2H3,(H,9,12).
What are the key properties of N,4-dimethyl-1,4-diazepane-1-carboxamide?
N,4-dimethyl-1,4-diazepane-1-carboxamide has a molecular weight of 171.24 g/mol, XLogP of -0.04, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,4-dimethyl-1,4-diazepane-1-carboxamide is sourced from PubChem (CID 59680276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).