About piperidin-1-yl(4,5,6,7-tetrahydro-2-benzothiophen-1-yl)methanone
piperidin-1-yl(4,5,6,7-tetrahydro-2-benzothiophen-1-yl)methanone (PubChem CID 596805) has the molecular formula C14H19NOS
and a molecular weight of 249.38 g/mol. Its IUPAC name is piperidin-1-yl(4,5,6,7-tetrahydro-2-benzothiophen-1-yl)methanone.
Molecular Properties
| Compound Name | piperidin-1-yl(4,5,6,7-tetrahydro-2-benzothiophen-1-yl)methanone |
| PubChem CID | 596805 |
| Molecular Formula | C14H19NOS |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | piperidin-1-yl(4,5,6,7-tetrahydro-2-benzothiophen-1-yl)methanone |
| SMILES | O=C(c1scc2c1CCCC2)N1CCCCC1 |
| InChI | InChI=1S/C14H19NOS/c16-14(15-8-4-1-5-9-15)13-12-7-3-2-6-11(12)10-17-13/h10H,1-9H2 |
| InChIKey | YUXAASKJLIZBMK-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze piperidin-1-yl(4,5,6,7-tetrahydro-2-benzothiophen-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidin-1-yl(4,5,6,7-tetrahydro-2-benzothiophen-1-yl)methanone?
The IUPAC name of piperidin-1-yl(4,5,6,7-tetrahydro-2-benzothiophen-1-yl)methanone (CID 596805) is piperidin-1-yl(4,5,6,7-tetrahydro-2-benzothiophen-1-yl)methanone.
What is the SMILES notation for piperidin-1-yl(4,5,6,7-tetrahydro-2-benzothiophen-1-yl)methanone?
The canonical SMILES for piperidin-1-yl(4,5,6,7-tetrahydro-2-benzothiophen-1-yl)methanone is O=C(c1scc2c1CCCC2)N1CCCCC1.
What is the InChIKey of piperidin-1-yl(4,5,6,7-tetrahydro-2-benzothiophen-1-yl)methanone?
The InChIKey is YUXAASKJLIZBMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NOS/c16-14(15-8-4-1-5-9-15)13-12-7-3-2-6-11(12)10-17-13/h10H,1-9H2.
What are the key properties of piperidin-1-yl(4,5,6,7-tetrahydro-2-benzothiophen-1-yl)methanone?
piperidin-1-yl(4,5,6,7-tetrahydro-2-benzothiophen-1-yl)methanone has a molecular weight of 249.38 g/mol, XLogP of 3.25, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for piperidin-1-yl(4,5,6,7-tetrahydro-2-benzothiophen-1-yl)methanone is sourced from PubChem (CID 596805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).