About 6-methylthieno[2,3-c]pyridin-7-one
6-methylthieno[2,3-c]pyridin-7-one (PubChem CID 59680669) has the molecular formula C8H7NOS
and a molecular weight of 165.22 g/mol. Its IUPAC name is 6-methylthieno[2,3-c]pyridin-7-one.
Molecular Properties
| Compound Name | 6-methylthieno[2,3-c]pyridin-7-one |
| PubChem CID | 59680669 |
| Molecular Formula | C8H7NOS |
| Molecular Weight | 165.22 g/mol |
| Exact Mass | 165.02 |
| IUPAC Name | 6-methylthieno[2,3-c]pyridin-7-one |
| SMILES | Cn1ccc2ccsc2c1=O |
| InChI | InChI=1S/C8H7NOS/c1-9-4-2-6-3-5-11-7(6)8(9)10/h2-5H,1H3 |
| InChIKey | VOPDFMXFGGRMJY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.22 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-methylthieno[2,3-c]pyridin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylthieno[2,3-c]pyridin-7-one?
The IUPAC name of 6-methylthieno[2,3-c]pyridin-7-one (CID 59680669) is 6-methylthieno[2,3-c]pyridin-7-one.
What is the SMILES notation for 6-methylthieno[2,3-c]pyridin-7-one?
The canonical SMILES for 6-methylthieno[2,3-c]pyridin-7-one is Cn1ccc2ccsc2c1=O.
What is the InChIKey of 6-methylthieno[2,3-c]pyridin-7-one?
The InChIKey is VOPDFMXFGGRMJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NOS/c1-9-4-2-6-3-5-11-7(6)8(9)10/h2-5H,1H3.
What are the key properties of 6-methylthieno[2,3-c]pyridin-7-one?
6-methylthieno[2,3-c]pyridin-7-one has a molecular weight of 165.22 g/mol, XLogP of 1.60, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylthieno[2,3-c]pyridin-7-one is sourced from PubChem (CID 59680669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).