About N-(4-bromobutyl)-N-[(1S,5S)-5-(3-cyanophenyl)-2-bicyclo[3.1.0]hexanyl]-methylboronamidic acid
N-(4-bromobutyl)-N-[(1S,5S)-5-(3-cyanophenyl)-2-bicyclo[3.1.0]hexanyl]-methylboronamidic acid (PubChem CID 59681115) has the molecular formula C18H24BBrN2O
and a molecular weight of 375.12 g/mol. Its IUPAC name is N-(4-bromobutyl)-N-[(1S,5S)-5-(3-cyanophenyl)-2-bicyclo[3.1.0]hexanyl]-methylboronamidic acid.
Molecular Properties
| Compound Name | N-(4-bromobutyl)-N-[(1S,5S)-5-(3-cyanophenyl)-2-bicyclo[3.1.0]hexanyl]-methylboronamidic acid |
| PubChem CID | 59681115 |
| Molecular Formula | C18H24BBrN2O |
| Molecular Weight | 375.12 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | N-(4-bromobutyl)-N-[(1S,5S)-5-(3-cyanophenyl)-2-bicyclo[3.1.0]hexanyl]-methylboronamidic acid |
| SMILES | CB(O)N(CCCCBr)C1CC[C@]2(c3cccc(C#N)c3)C[C@H]12 |
| InChI | InChI=1S/C18H24BBrN2O/c1-19(23)22(10-3-2-9-20)17-7-8-18(12-16(17)18)15-6-4-5-14(11-15)13-21/h4-6,11,16-17,23H,2-3,7-10,12H2,1H3/t16-,17?,18-/m1/s1 |
| InChIKey | SSPQVRBRSSNNHT-GVYDCBATSA-N |
| XLogP | 3.57 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.12 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-(4-bromobutyl)-N-[(1S,5S)-5-(3-cyanophenyl)-2-bicyclo[3.1.0]hexanyl]-methylboronamidic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-bromobutyl)-N-[(1S,5S)-5-(3-cyanophenyl)-2-bicyclo[3.1.0]hexanyl]-methylboronamidic acid?
The IUPAC name of N-(4-bromobutyl)-N-[(1S,5S)-5-(3-cyanophenyl)-2-bicyclo[3.1.0]hexanyl]-methylboronamidic acid (CID 59681115) is N-(4-bromobutyl)-N-[(1S,5S)-5-(3-cyanophenyl)-2-bicyclo[3.1.0]hexanyl]-methylboronamidic acid.
What is the SMILES notation for N-(4-bromobutyl)-N-[(1S,5S)-5-(3-cyanophenyl)-2-bicyclo[3.1.0]hexanyl]-methylboronamidic acid?
The canonical SMILES for N-(4-bromobutyl)-N-[(1S,5S)-5-(3-cyanophenyl)-2-bicyclo[3.1.0]hexanyl]-methylboronamidic acid is CB(O)N(CCCCBr)C1CC[C@]2(c3cccc(C#N)c3)C[C@H]12.
What is the InChIKey of N-(4-bromobutyl)-N-[(1S,5S)-5-(3-cyanophenyl)-2-bicyclo[3.1.0]hexanyl]-methylboronamidic acid?
The InChIKey is SSPQVRBRSSNNHT-GVYDCBATSA-N. The full InChI is InChI=1S/C18H24BBrN2O/c1-19(23)22(10-3-2-9-20)17-7-8-18(12-16(17)18)15-6-4-5-14(11-15)13-21/h4-6,11,16-17,23H,2-3,7-10,12H2,1H3/t16-,17?,18-/m1/s1.
What are the key properties of N-(4-bromobutyl)-N-[(1S,5S)-5-(3-cyanophenyl)-2-bicyclo[3.1.0]hexanyl]-methylboronamidic acid?
N-(4-bromobutyl)-N-[(1S,5S)-5-(3-cyanophenyl)-2-bicyclo[3.1.0]hexanyl]-methylboronamidic acid has a molecular weight of 375.12 g/mol, XLogP of 3.57, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-bromobutyl)-N-[(1S,5S)-5-(3-cyanophenyl)-2-bicyclo[3.1.0]hexanyl]-methylboronamidic acid is sourced from PubChem (CID 59681115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).