About CID 59681144
CID 59681144 (PubChem CID 59681144) has the molecular formula C28H36Cl2N3O2S+
and a molecular weight of 549.59 g/mol.
Molecular Properties
| Compound Name | CID 59681144 |
| PubChem CID | 59681144 |
| Molecular Formula | C28H36Cl2N3O2S+ |
| Molecular Weight | 549.59 g/mol |
| Exact Mass | 548.19 |
| IUPAC Name | — |
| SMILES | C[SH+](=O)c1cccc([C@@]23CC[C@@H](N(CCCN4CCCC4)C(=O)Nc4ccc(Cl)c(Cl)c4)CC2C3)c1 |
| InChI | InChI=1S/C28H35Cl2N3O2S/c1-36(35)24-7-4-6-20(17-24)28-11-10-23(16-21(28)19-28)33(15-5-14-32-12-2-3-13-32)27(34)31-22-8-9-25(29)26(30)18-22/h4,6-9,17-18,21,23H,2-3,5,10-16,19H2,1H3,(H,31,34)/p+1/t21?,23-,28+,36?/m1/s1 |
| InChIKey | KUIJRSRBCYGAHH-LVFNPVSZSA-O |
| XLogP | 6.51 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 549.59 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze CID 59681144 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59681144?
The IUPAC name of CID 59681144 (CID 59681144) is not available.
What is the SMILES notation for CID 59681144?
The canonical SMILES for CID 59681144 is C[SH+](=O)c1cccc([C@@]23CC[C@@H](N(CCCN4CCCC4)C(=O)Nc4ccc(Cl)c(Cl)c4)CC2C3)c1.
What is the InChIKey of CID 59681144?
The InChIKey is KUIJRSRBCYGAHH-LVFNPVSZSA-O. The full InChI is InChI=1S/C28H35Cl2N3O2S/c1-36(35)24-7-4-6-20(17-24)28-11-10-23(16-21(28)19-28)33(15-5-14-32-12-2-3-13-32)27(34)31-22-8-9-25(29)26(30)18-22/h4,6-9,17-18,21,23H,2-3,5,10-16,19H2,1H3,(H,31,34)/p+1/t21?,23-,28+,36?/m1/s1.
What are the key properties of CID 59681144?
CID 59681144 has a molecular weight of 549.59 g/mol, XLogP of 6.51, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59681144 is sourced from PubChem (CID 59681144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).