C17H26N2O5 — CID 59681911
tert-butyl N-[1-cyclopentyl-2-[(3R,4S)-4-methyl-2,5-dioxopyrrolidin-3-yl]-2-oxoethyl]carbamate (PubChem CID 59681911) has the molecular formula C17H26N2O5 and a molecular weight of 338.40 g/mol. Its IUPAC name is tert-butyl N-[1-cyclopentyl-2-[(3R,4S)-4-methyl-2,5-dioxopyrrolidin-3-yl]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[1-cyclopentyl-2-[(3R,4S)-4-methyl-2,5-dioxopyrrolidin-3-yl]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 59681911 |
| Molecular Formula | C17H26N2O5 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | tert-butyl N-[1-cyclopentyl-2-[(3R,4S)-4-methyl-2,5-dioxopyrrolidin-3-yl]-2-oxoethyl]carbamate |
| SMILES | C[C@@H]1C(=O)NC(=O)[C@H]1C(=O)C(NC(=O)OC(C)(C)C)C1CCCC1 |
| InChI | InChI=1S/C17H26N2O5/c1-9-11(15(22)19-14(9)21)13(20)12(10-7-5-6-8-10)18-16(23)24-17(2,3)4/h9-12H,5-8H2,1-4H3,(H,18,23)(H,19,21,22)/t9-,11+,12?/m0/s1 |
| InChIKey | BZUCWGRGUTYERP-WKAHHKJFSA-N |
| XLogP | 1.55 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|