About (3R,4S)-3-[(2S)-2-amino-3-methylbutanoyl]-1-methoxy-4-methylpyrrolidine-2,5-dione
(3R,4S)-3-[(2S)-2-amino-3-methylbutanoyl]-1-methoxy-4-methylpyrrolidine-2,5-dione (PubChem CID 59681918) has the molecular formula C11H18N2O4
and a molecular weight of 242.27 g/mol. Its IUPAC name is (3R,4S)-3-[(2S)-2-amino-3-methylbutanoyl]-1-methoxy-4-methylpyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | (3R,4S)-3-[(2S)-2-amino-3-methylbutanoyl]-1-methoxy-4-methylpyrrolidine-2,5-dione |
| PubChem CID | 59681918 |
| Molecular Formula | C11H18N2O4 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | (3R,4S)-3-[(2S)-2-amino-3-methylbutanoyl]-1-methoxy-4-methylpyrrolidine-2,5-dione |
| SMILES | CON1C(=O)[C@@H](C(=O)[C@@H](N)C(C)C)[C@H](C)C1=O |
| InChI | InChI=1S/C11H18N2O4/c1-5(2)8(12)9(14)7-6(3)10(15)13(17-4)11(7)16/h5-8H,12H2,1-4H3/t6-,7+,8-/m0/s1 |
| InChIKey | JRDOSZTVHHDMEF-RNJXMRFFSA-N |
| XLogP | -0.28 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (3R,4S)-3-[(2S)-2-amino-3-methylbutanoyl]-1-methoxy-4-methylpyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4S)-3-[(2S)-2-amino-3-methylbutanoyl]-1-methoxy-4-methylpyrrolidine-2,5-dione?
The IUPAC name of (3R,4S)-3-[(2S)-2-amino-3-methylbutanoyl]-1-methoxy-4-methylpyrrolidine-2,5-dione (CID 59681918) is (3R,4S)-3-[(2S)-2-amino-3-methylbutanoyl]-1-methoxy-4-methylpyrrolidine-2,5-dione.
What is the SMILES notation for (3R,4S)-3-[(2S)-2-amino-3-methylbutanoyl]-1-methoxy-4-methylpyrrolidine-2,5-dione?
The canonical SMILES for (3R,4S)-3-[(2S)-2-amino-3-methylbutanoyl]-1-methoxy-4-methylpyrrolidine-2,5-dione is CON1C(=O)[C@@H](C(=O)[C@@H](N)C(C)C)[C@H](C)C1=O.
What is the InChIKey of (3R,4S)-3-[(2S)-2-amino-3-methylbutanoyl]-1-methoxy-4-methylpyrrolidine-2,5-dione?
The InChIKey is JRDOSZTVHHDMEF-RNJXMRFFSA-N. The full InChI is InChI=1S/C11H18N2O4/c1-5(2)8(12)9(14)7-6(3)10(15)13(17-4)11(7)16/h5-8H,12H2,1-4H3/t6-,7+,8-/m0/s1.
What are the key properties of (3R,4S)-3-[(2S)-2-amino-3-methylbutanoyl]-1-methoxy-4-methylpyrrolidine-2,5-dione?
(3R,4S)-3-[(2S)-2-amino-3-methylbutanoyl]-1-methoxy-4-methylpyrrolidine-2,5-dione has a molecular weight of 242.27 g/mol, XLogP of -0.28, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4S)-3-[(2S)-2-amino-3-methylbutanoyl]-1-methoxy-4-methylpyrrolidine-2,5-dione is sourced from PubChem (CID 59681918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).