C12H18N2O3 — CID 59681928
(3R,4S)-3-[(2S)-2-amino-2-cyclopentylacetyl]-4-methylpyrrolidine-2,5-dione (PubChem CID 59681928) has the molecular formula C12H18N2O3 and a molecular weight of 238.29 g/mol. Its IUPAC name is (3R,4S)-3-[(2S)-2-amino-2-cyclopentylacetyl]-4-methylpyrrolidine-2,5-dione.
| Compound Name | (3R,4S)-3-[(2S)-2-amino-2-cyclopentylacetyl]-4-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 59681928 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | (3R,4S)-3-[(2S)-2-amino-2-cyclopentylacetyl]-4-methylpyrrolidine-2,5-dione |
| SMILES | C[C@@H]1C(=O)NC(=O)[C@H]1C(=O)[C@@H](N)C1CCCC1 |
| InChI | InChI=1S/C12H18N2O3/c1-6-8(12(17)14-11(6)16)10(15)9(13)7-4-2-3-5-7/h6-9H,2-5,13H2,1H3,(H,14,16,17)/t6-,8+,9-/m0/s1 |
| InChIKey | NTUKQXXAIXAOSR-ZQARSLAVSA-N |
| XLogP | -0.02 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|