C11H18N2O3 — CID 59681957
(3R,4S)-3-[(2S)-2-amino-4-methylpentanoyl]-4-methylpyrrolidine-2,5-dione (PubChem CID 59681957) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is (3R,4S)-3-[(2S)-2-amino-4-methylpentanoyl]-4-methylpyrrolidine-2,5-dione.
| Compound Name | (3R,4S)-3-[(2S)-2-amino-4-methylpentanoyl]-4-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 59681957 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | (3R,4S)-3-[(2S)-2-amino-4-methylpentanoyl]-4-methylpyrrolidine-2,5-dione |
| SMILES | CC(C)C[C@H](N)C(=O)[C@@H]1C(=O)NC(=O)[C@H]1C |
| InChI | InChI=1S/C11H18N2O3/c1-5(2)4-7(12)9(14)8-6(3)10(15)13-11(8)16/h5-8H,4,12H2,1-3H3,(H,13,15,16)/t6-,7-,8+/m0/s1 |
| InChIKey | LCFFKRYLLLBOOG-BIIVOSGPSA-N |
| XLogP | -0.16 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|