C20H28N2O3 — CID 59682131
methyl 2-[[4-(3-piperidin-4-ylpropanoylamino)phenyl]methyl]but-3-enoate (PubChem CID 59682131) has the molecular formula C20H28N2O3 and a molecular weight of 344.46 g/mol. Its IUPAC name is methyl 2-[[4-(3-piperidin-4-ylpropanoylamino)phenyl]methyl]but-3-enoate.
| Compound Name | methyl 2-[[4-(3-piperidin-4-ylpropanoylamino)phenyl]methyl]but-3-enoate |
|---|---|
| PubChem CID | 59682131 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | methyl 2-[[4-(3-piperidin-4-ylpropanoylamino)phenyl]methyl]but-3-enoate |
| SMILES | C=CC(Cc1ccc(NC(=O)CCC2CCNCC2)cc1)C(=O)OC |
| InChI | InChI=1S/C20H28N2O3/c1-3-17(20(24)25-2)14-16-4-7-18(8-5-16)22-19(23)9-6-15-10-12-21-13-11-15/h3-5,7-8,15,17,21H,1,6,9-14H2,2H3,(H,22,23) |
| InChIKey | KMHNIGRUPJPBHX-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|