C18H24ClN6O3- — CID 59682172
4-[[4-(chloroamino)-1-methylpyrrole-2-carbonyl]amino]-1-methyl-N-(2-morpholin-4-ylethyl)pyrrole-2-carboximidate (PubChem CID 59682172) has the molecular formula C18H24ClN6O3- and a molecular weight of 407.88 g/mol. Its IUPAC name is 4-[[4-(chloroamino)-1-methylpyrrole-2-carbonyl]amino]-1-methyl-N-(2-morpholin-4-ylethyl)pyrrole-2-carboximidate.
| Compound Name | 4-[[4-(chloroamino)-1-methylpyrrole-2-carbonyl]amino]-1-methyl-N-(2-morpholin-4-ylethyl)pyrrole-2-carboximidate |
|---|---|
| PubChem CID | 59682172 |
| Molecular Formula | C18H24ClN6O3- |
| Molecular Weight | 407.88 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 4-[[4-(chloroamino)-1-methylpyrrole-2-carbonyl]amino]-1-methyl-N-(2-morpholin-4-ylethyl)pyrrole-2-carboximidate |
| SMILES | Cn1cc(NCl)cc1C(=O)Nc1cc(/C([O-])=N/CCN2CCOCC2)n(C)c1 |
| InChI | InChI=1S/C18H25ClN6O3/c1-23-11-13(21-18(27)16-10-14(22-19)12-24(16)2)9-15(23)17(26)20-3-4-25-5-7-28-8-6-25/h9-12,22H,3-8H2,1-2H3,(H,20,26)(H,21,27)/p-1 |
| InChIKey | JLTZROZXPAWJHI-UHFFFAOYSA-M |
| XLogP | 0.62 |
| TPSA | 98.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.88 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|