C19H12Cl2F6N2O3 — CID 59682299
[1-(5,6-dichloro-1H-benzimidazol-2-yl)-2,2,2-trifluoroethyl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 59682299) has the molecular formula C19H12Cl2F6N2O3 and a molecular weight of 501.21 g/mol. Its IUPAC name is [1-(5,6-dichloro-1H-benzimidazol-2-yl)-2,2,2-trifluoroethyl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [1-(5,6-dichloro-1H-benzimidazol-2-yl)-2,2,2-trifluoroethyl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 59682299 |
| Molecular Formula | C19H12Cl2F6N2O3 |
| Molecular Weight | 501.21 g/mol |
| Exact Mass | 500.01 |
| IUPAC Name | [1-(5,6-dichloro-1H-benzimidazol-2-yl)-2,2,2-trifluoroethyl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | CO[C@@](C(=O)OC(c1nc2cc(Cl)c(Cl)cc2[nH]1)C(F)(F)F)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C19H12Cl2F6N2O3/c1-31-17(19(25,26)27,9-5-3-2-4-6-9)16(30)32-14(18(22,23)24)15-28-12-7-10(20)11(21)8-13(12)29-15/h2-8,14H,1H3,(H,28,29)/t14?,17-/m1/s1 |
| InChIKey | DEBJJHRLQGCAHG-FBMWCMRBSA-N |
| XLogP | 6.12 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.21 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |