C5H10N6 — CID 59682514
2,3,6,7-tetrahydro-1H-purine-2,6-diamine (PubChem CID 59682514) has the molecular formula C5H10N6 and a molecular weight of 154.18 g/mol. Its IUPAC name is 2,3,6,7-tetrahydro-1H-purine-2,6-diamine.
| Compound Name | 2,3,6,7-tetrahydro-1H-purine-2,6-diamine |
|---|---|
| PubChem CID | 59682514 |
| Molecular Formula | C5H10N6 |
| Molecular Weight | 154.18 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | 2,3,6,7-tetrahydro-1H-purine-2,6-diamine |
| SMILES | NC1Nc2nc[nH]c2C(N)N1 |
| InChI | InChI=1S/C5H10N6/c6-3-2-4(9-1-8-2)11-5(7)10-3/h1,3,5,10-11H,6-7H2,(H,8,9) |
| InChIKey | TXXJCHIRQOAGCE-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.18 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |