C28H35ClFN5O2Si — CID 59682948
4-(3-chloro-2-fluorophenoxy)-1-[[6-[[1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]amino]-2-pyridinyl]methyl]cyclohexane-1-carbonitrile (PubChem CID 59682948) has the molecular formula C28H35ClFN5O2Si and a molecular weight of 556.16 g/mol. Its IUPAC name is 4-(3-chloro-2-fluorophenoxy)-1-[[6-[[1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]amino]-2-pyridinyl]methyl]cyclohexane-1-carbonitrile.
| Compound Name | 4-(3-chloro-2-fluorophenoxy)-1-[[6-[[1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]amino]-2-pyridinyl]methyl]cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 59682948 |
| Molecular Formula | C28H35ClFN5O2Si |
| Molecular Weight | 556.16 g/mol |
| Exact Mass | 555.22 |
| IUPAC Name | 4-(3-chloro-2-fluorophenoxy)-1-[[6-[[1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]amino]-2-pyridinyl]methyl]cyclohexane-1-carbonitrile |
| SMILES | C[Si](C)(C)CCOCn1ccc(Nc2cccc(CC3(C#N)CCC(Oc4cccc(Cl)c4F)CC3)n2)n1 |
| InChI | InChI=1S/C28H35ClFN5O2Si/c1-38(2,3)17-16-36-20-35-15-12-26(34-35)33-25-9-4-6-21(32-25)18-28(19-31)13-10-22(11-14-28)37-24-8-5-7-23(29)27(24)30/h4-9,12,15,22H,10-11,13-14,16-18,20H2,1-3H3,(H,32,33,34) |
| InChIKey | ZFQLPSJGASAAHO-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.16 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|