C20H20BrN3O2S — CID 59683000
8-(3-bromophenyl)-3-methoxy-8-(4-methoxyphenyl)-2,3,4,7-tetrahydroimidazo[1,5-a]pyrimidine-6-thione (PubChem CID 59683000) has the molecular formula C20H20BrN3O2S and a molecular weight of 446.37 g/mol. Its IUPAC name is 8-(3-bromophenyl)-3-methoxy-8-(4-methoxyphenyl)-2,3,4,7-tetrahydroimidazo[1,5-a]pyrimidine-6-thione.
| Compound Name | 8-(3-bromophenyl)-3-methoxy-8-(4-methoxyphenyl)-2,3,4,7-tetrahydroimidazo[1,5-a]pyrimidine-6-thione |
|---|---|
| PubChem CID | 59683000 |
| Molecular Formula | C20H20BrN3O2S |
| Molecular Weight | 446.37 g/mol |
| Exact Mass | 445.05 |
| IUPAC Name | 8-(3-bromophenyl)-3-methoxy-8-(4-methoxyphenyl)-2,3,4,7-tetrahydroimidazo[1,5-a]pyrimidine-6-thione |
| SMILES | COc1ccc(C2(c3cccc(Br)c3)NC(=S)N3CC(OC)CN=C32)cc1 |
| InChI | InChI=1S/C20H20BrN3O2S/c1-25-16-8-6-13(7-9-16)20(14-4-3-5-15(21)10-14)18-22-11-17(26-2)12-24(18)19(27)23-20/h3-10,17H,11-12H2,1-2H3,(H,23,27) |
| InChIKey | NKRWEJFAURHEJU-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.37 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|