About 3,5-dimethyl-6H-thieno[2,3-b]pyrrole
3,5-dimethyl-6H-thieno[2,3-b]pyrrole (PubChem CID 59683331) has the molecular formula C8H9NS
and a molecular weight of 151.23 g/mol. Its IUPAC name is 3,5-dimethyl-6H-thieno[2,3-b]pyrrole.
Molecular Properties
| Compound Name | 3,5-dimethyl-6H-thieno[2,3-b]pyrrole |
| PubChem CID | 59683331 |
| Molecular Formula | C8H9NS |
| Molecular Weight | 151.23 g/mol |
| Exact Mass | 151.05 |
| IUPAC Name | 3,5-dimethyl-6H-thieno[2,3-b]pyrrole |
| SMILES | Cc1cc2c(C)csc2[nH]1 |
| InChI | InChI=1S/C8H9NS/c1-5-4-10-8-7(5)3-6(2)9-8/h3-4,9H,1-2H3 |
| InChIKey | HSTCODQTYOBWDA-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.23 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,5-dimethyl-6H-thieno[2,3-b]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-6H-thieno[2,3-b]pyrrole?
The IUPAC name of 3,5-dimethyl-6H-thieno[2,3-b]pyrrole (CID 59683331) is 3,5-dimethyl-6H-thieno[2,3-b]pyrrole.
What is the SMILES notation for 3,5-dimethyl-6H-thieno[2,3-b]pyrrole?
The canonical SMILES for 3,5-dimethyl-6H-thieno[2,3-b]pyrrole is Cc1cc2c(C)csc2[nH]1.
What is the InChIKey of 3,5-dimethyl-6H-thieno[2,3-b]pyrrole?
The InChIKey is HSTCODQTYOBWDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NS/c1-5-4-10-8-7(5)3-6(2)9-8/h3-4,9H,1-2H3.
What are the key properties of 3,5-dimethyl-6H-thieno[2,3-b]pyrrole?
3,5-dimethyl-6H-thieno[2,3-b]pyrrole has a molecular weight of 151.23 g/mol, XLogP of 2.85, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-6H-thieno[2,3-b]pyrrole is sourced from PubChem (CID 59683331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).