About 5-methyl-4H-pyrrolo[2,3-d][1,3]oxazole
5-methyl-4H-pyrrolo[2,3-d][1,3]oxazole (PubChem CID 59683333) has the molecular formula C6H6N2O
and a molecular weight of 122.13 g/mol. Its IUPAC name is 5-methyl-4H-pyrrolo[2,3-d][1,3]oxazole.
Molecular Properties
| Compound Name | 5-methyl-4H-pyrrolo[2,3-d][1,3]oxazole |
| PubChem CID | 59683333 |
| Molecular Formula | C6H6N2O |
| Molecular Weight | 122.13 g/mol |
| Exact Mass | 122.05 |
| IUPAC Name | 5-methyl-4H-pyrrolo[2,3-d][1,3]oxazole |
| SMILES | Cc1cc2ocnc2[nH]1 |
| InChI | InChI=1S/C6H6N2O/c1-4-2-5-6(8-4)7-3-9-5/h2-3,8H,1H3 |
| InChIKey | JYSHKAZPQGNSLQ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.13 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methyl-4H-pyrrolo[2,3-d][1,3]oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-4H-pyrrolo[2,3-d][1,3]oxazole?
The IUPAC name of 5-methyl-4H-pyrrolo[2,3-d][1,3]oxazole (CID 59683333) is 5-methyl-4H-pyrrolo[2,3-d][1,3]oxazole.
What is the SMILES notation for 5-methyl-4H-pyrrolo[2,3-d][1,3]oxazole?
The canonical SMILES for 5-methyl-4H-pyrrolo[2,3-d][1,3]oxazole is Cc1cc2ocnc2[nH]1.
What is the InChIKey of 5-methyl-4H-pyrrolo[2,3-d][1,3]oxazole?
The InChIKey is JYSHKAZPQGNSLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O/c1-4-2-5-6(8-4)7-3-9-5/h2-3,8H,1H3.
What are the key properties of 5-methyl-4H-pyrrolo[2,3-d][1,3]oxazole?
5-methyl-4H-pyrrolo[2,3-d][1,3]oxazole has a molecular weight of 122.13 g/mol, XLogP of 1.46, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-4H-pyrrolo[2,3-d][1,3]oxazole is sourced from PubChem (CID 59683333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).