About 3-bromo-5-methyl-4H-furo[3,2-b]pyrrole
3-bromo-5-methyl-4H-furo[3,2-b]pyrrole (PubChem CID 59683343) has the molecular formula C7H6BrNO
and a molecular weight of 200.03 g/mol. Its IUPAC name is 3-bromo-5-methyl-4H-furo[3,2-b]pyrrole.
Molecular Properties
| Compound Name | 3-bromo-5-methyl-4H-furo[3,2-b]pyrrole |
| PubChem CID | 59683343 |
| Molecular Formula | C7H6BrNO |
| Molecular Weight | 200.03 g/mol |
| Exact Mass | 198.96 |
| IUPAC Name | 3-bromo-5-methyl-4H-furo[3,2-b]pyrrole |
| SMILES | Cc1cc2occ(Br)c2[nH]1 |
| InChI | InChI=1S/C7H6BrNO/c1-4-2-6-7(9-4)5(8)3-10-6/h2-3,9H,1H3 |
| InChIKey | SOQAVSZBRXJHRP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 28.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.03 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-bromo-5-methyl-4H-furo[3,2-b]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-5-methyl-4H-furo[3,2-b]pyrrole?
The IUPAC name of 3-bromo-5-methyl-4H-furo[3,2-b]pyrrole (CID 59683343) is 3-bromo-5-methyl-4H-furo[3,2-b]pyrrole.
What is the SMILES notation for 3-bromo-5-methyl-4H-furo[3,2-b]pyrrole?
The canonical SMILES for 3-bromo-5-methyl-4H-furo[3,2-b]pyrrole is Cc1cc2occ(Br)c2[nH]1.
What is the InChIKey of 3-bromo-5-methyl-4H-furo[3,2-b]pyrrole?
The InChIKey is SOQAVSZBRXJHRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BrNO/c1-4-2-6-7(9-4)5(8)3-10-6/h2-3,9H,1H3.
What are the key properties of 3-bromo-5-methyl-4H-furo[3,2-b]pyrrole?
3-bromo-5-methyl-4H-furo[3,2-b]pyrrole has a molecular weight of 200.03 g/mol, XLogP of 2.83, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-5-methyl-4H-furo[3,2-b]pyrrole is sourced from PubChem (CID 59683343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).