About N-[(6-tert-butylnaphthalen-1-yl)methyl]-N,2,2-trimethylpropanamide
N-[(6-tert-butylnaphthalen-1-yl)methyl]-N,2,2-trimethylpropanamide (PubChem CID 59683373) has the molecular formula C21H29NO
and a molecular weight of 311.47 g/mol. Its IUPAC name is N-[(6-tert-butylnaphthalen-1-yl)methyl]-N,2,2-trimethylpropanamide.
Molecular Properties
| Compound Name | N-[(6-tert-butylnaphthalen-1-yl)methyl]-N,2,2-trimethylpropanamide |
| PubChem CID | 59683373 |
| Molecular Formula | C21H29NO |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | N-[(6-tert-butylnaphthalen-1-yl)methyl]-N,2,2-trimethylpropanamide |
| SMILES | CN(Cc1cccc2cc(C(C)(C)C)ccc12)C(=O)C(C)(C)C |
| InChI | InChI=1S/C21H29NO/c1-20(2,3)17-11-12-18-15(13-17)9-8-10-16(18)14-22(7)19(23)21(4,5)6/h8-13H,14H2,1-7H3 |
| InChIKey | GTIZUHYWOGHFQW-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[(6-tert-butylnaphthalen-1-yl)methyl]-N,2,2-trimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(6-tert-butylnaphthalen-1-yl)methyl]-N,2,2-trimethylpropanamide?
The IUPAC name of N-[(6-tert-butylnaphthalen-1-yl)methyl]-N,2,2-trimethylpropanamide (CID 59683373) is N-[(6-tert-butylnaphthalen-1-yl)methyl]-N,2,2-trimethylpropanamide.
What is the SMILES notation for N-[(6-tert-butylnaphthalen-1-yl)methyl]-N,2,2-trimethylpropanamide?
The canonical SMILES for N-[(6-tert-butylnaphthalen-1-yl)methyl]-N,2,2-trimethylpropanamide is CN(Cc1cccc2cc(C(C)(C)C)ccc12)C(=O)C(C)(C)C.
What is the InChIKey of N-[(6-tert-butylnaphthalen-1-yl)methyl]-N,2,2-trimethylpropanamide?
The InChIKey is GTIZUHYWOGHFQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H29NO/c1-20(2,3)17-11-12-18-15(13-17)9-8-10-16(18)14-22(7)19(23)21(4,5)6/h8-13H,14H2,1-7H3.
What are the key properties of N-[(6-tert-butylnaphthalen-1-yl)methyl]-N,2,2-trimethylpropanamide?
N-[(6-tert-butylnaphthalen-1-yl)methyl]-N,2,2-trimethylpropanamide has a molecular weight of 311.47 g/mol, XLogP of 5.14, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(6-tert-butylnaphthalen-1-yl)methyl]-N,2,2-trimethylpropanamide is sourced from PubChem (CID 59683373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).