About N-[(1R,3S)-5-amino-2-adamantyl]-2-methyl-2-(2-methylphenoxy)propanamide
N-[(1R,3S)-5-amino-2-adamantyl]-2-methyl-2-(2-methylphenoxy)propanamide (PubChem CID 59684601) has the molecular formula C21H30N2O2
and a molecular weight of 342.48 g/mol. Its IUPAC name is N-[(1R,3S)-5-amino-2-adamantyl]-2-methyl-2-(2-methylphenoxy)propanamide.
Molecular Properties
| Compound Name | N-[(1R,3S)-5-amino-2-adamantyl]-2-methyl-2-(2-methylphenoxy)propanamide |
| PubChem CID | 59684601 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | N-[(1R,3S)-5-amino-2-adamantyl]-2-methyl-2-(2-methylphenoxy)propanamide |
| SMILES | Cc1ccccc1OC(C)(C)C(=O)NC1[C@@H]2CC3C[C@H]1CC(N)(C3)C2 |
| InChI | InChI=1S/C21H30N2O2/c1-13-6-4-5-7-17(13)25-20(2,3)19(24)23-18-15-8-14-9-16(18)12-21(22,10-14)11-15/h4-7,14-16,18H,8-12,22H2,1-3H3,(H,23,24)/t14?,15-,16+,18?,21? |
| InChIKey | ABINKVWUTIGYLM-HTKCDMBSSA-N |
| XLogP | 3.17 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(1R,3S)-5-amino-2-adamantyl]-2-methyl-2-(2-methylphenoxy)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R,3S)-5-amino-2-adamantyl]-2-methyl-2-(2-methylphenoxy)propanamide?
The IUPAC name of N-[(1R,3S)-5-amino-2-adamantyl]-2-methyl-2-(2-methylphenoxy)propanamide (CID 59684601) is N-[(1R,3S)-5-amino-2-adamantyl]-2-methyl-2-(2-methylphenoxy)propanamide.
What is the SMILES notation for N-[(1R,3S)-5-amino-2-adamantyl]-2-methyl-2-(2-methylphenoxy)propanamide?
The canonical SMILES for N-[(1R,3S)-5-amino-2-adamantyl]-2-methyl-2-(2-methylphenoxy)propanamide is Cc1ccccc1OC(C)(C)C(=O)NC1[C@@H]2CC3C[C@H]1CC(N)(C3)C2.
What is the InChIKey of N-[(1R,3S)-5-amino-2-adamantyl]-2-methyl-2-(2-methylphenoxy)propanamide?
The InChIKey is ABINKVWUTIGYLM-HTKCDMBSSA-N. The full InChI is InChI=1S/C21H30N2O2/c1-13-6-4-5-7-17(13)25-20(2,3)19(24)23-18-15-8-14-9-16(18)12-21(22,10-14)11-15/h4-7,14-16,18H,8-12,22H2,1-3H3,(H,23,24)/t14?,15-,16+,18?,21?.
What are the key properties of N-[(1R,3S)-5-amino-2-adamantyl]-2-methyl-2-(2-methylphenoxy)propanamide?
N-[(1R,3S)-5-amino-2-adamantyl]-2-methyl-2-(2-methylphenoxy)propanamide has a molecular weight of 342.48 g/mol, XLogP of 3.17, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R,3S)-5-amino-2-adamantyl]-2-methyl-2-(2-methylphenoxy)propanamide is sourced from PubChem (CID 59684601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).