C21H29NO3 — CID 59684649
N-[(1S,3R)-5-hydroxy-2-adamantyl]-2-methyl-2-(3-methylphenoxy)propanamide (PubChem CID 59684649) has the molecular formula C21H29NO3 and a molecular weight of 343.47 g/mol. Its IUPAC name is N-[(1S,3R)-5-hydroxy-2-adamantyl]-2-methyl-2-(3-methylphenoxy)propanamide.
| Compound Name | N-[(1S,3R)-5-hydroxy-2-adamantyl]-2-methyl-2-(3-methylphenoxy)propanamide |
|---|---|
| PubChem CID | 59684649 |
| Molecular Formula | C21H29NO3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | N-[(1S,3R)-5-hydroxy-2-adamantyl]-2-methyl-2-(3-methylphenoxy)propanamide |
| SMILES | Cc1cccc(OC(C)(C)C(=O)NC2[C@@H]3CC4C[C@H]2CC(O)(C4)C3)c1 |
| InChI | InChI=1S/C21H29NO3/c1-13-5-4-6-17(7-13)25-20(2,3)19(23)22-18-15-8-14-9-16(18)12-21(24,10-14)11-15/h4-7,14-16,18,24H,8-12H2,1-3H3,(H,22,23)/t14?,15-,16+,18?,21? |
| InChIKey | KCVOFVCRBVJBKF-HTKCDMBSSA-N |
| XLogP | 3.21 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |