C9H14O4 — CID 59684842
1-(2,2-dimethyl-1,3-dioxolan-4-yl)butane-1,3-dione (PubChem CID 59684842) has the molecular formula C9H14O4 and a molecular weight of 186.21 g/mol. Its IUPAC name is 1-(2,2-dimethyl-1,3-dioxolan-4-yl)butane-1,3-dione.
| Compound Name | 1-(2,2-dimethyl-1,3-dioxolan-4-yl)butane-1,3-dione |
|---|---|
| PubChem CID | 59684842 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 1-(2,2-dimethyl-1,3-dioxolan-4-yl)butane-1,3-dione |
| SMILES | CC(=O)CC(=O)C1COC(C)(C)O1 |
| InChI | InChI=1S/C9H14O4/c1-6(10)4-7(11)8-5-12-9(2,3)13-8/h8H,4-5H2,1-3H3 |
| InChIKey | AQTQSIZJNVDFKO-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|